C27H34ClFN4O9 — CID 69263911
2-[(4-chloropyrazol-1-yl)methyl]-3-(5-fluorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)-N,N-dimethylpropanamide;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 69263911) has the molecular formula C27H34ClFN4O9 and a molecular weight of 613.04 g/mol. Its IUPAC name is 2-[(4-chloropyrazol-1-yl)methyl]-3-(5-fluorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)-N,N-dimethylpropanamide;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 2-[(4-chloropyrazol-1-yl)methyl]-3-(5-fluorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)-N,N-dimethylpropanamide;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 69263911 |
| Molecular Formula | C27H34ClFN4O9 |
| Molecular Weight | 613.04 g/mol |
| Exact Mass | 612.20 |
| IUPAC Name | 2-[(4-chloropyrazol-1-yl)methyl]-3-(5-fluorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)-N,N-dimethylpropanamide;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CN(C)C(=O)C(CN1CCC2(CC1)OCc1ccc(F)cc12)Cn1cc(Cl)cn1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H26ClFN4O2.C6H8O7/c1-25(2)20(28)16(12-27-13-17(22)10-24-27)11-26-7-5-21(6-8-26)19-9-18(23)4-3-15(19)14-29-21;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-4,9-10,13,16H,5-8,11-12,14H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | YERVZWXOPMGHLZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 182.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.04 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |