C29H38FN3O10S — CID 69264390
N-ethyl-2-[(5-fluorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)methyl]-N-(2-hydroxyethyl)-3-(1,3-thiazol-4-yl)propanamide;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 69264390) has the molecular formula C29H38FN3O10S and a molecular weight of 639.70 g/mol. Its IUPAC name is N-ethyl-2-[(5-fluorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)methyl]-N-(2-hydroxyethyl)-3-(1,3-thiazol-4-yl)propanamide;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | N-ethyl-2-[(5-fluorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)methyl]-N-(2-hydroxyethyl)-3-(1,3-thiazol-4-yl)propanamide;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 69264390 |
| Molecular Formula | C29H38FN3O10S |
| Molecular Weight | 639.70 g/mol |
| Exact Mass | 639.23 |
| IUPAC Name | N-ethyl-2-[(5-fluorospiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)methyl]-N-(2-hydroxyethyl)-3-(1,3-thiazol-4-yl)propanamide;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CCN(CCO)C(=O)C(Cc1cscn1)CN1CCC2(CC1)OCc1ccc(F)cc12.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H30FN3O3S.C6H8O7/c1-2-27(9-10-28)22(29)18(11-20-15-31-16-25-20)13-26-7-5-23(6-8-26)21-12-19(24)4-3-17(21)14-30-23;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-4,12,15-16,18,28H,2,5-11,13-14H2,1H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | HJFRHMRZQBRUSD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 198.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.70 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |