C33H34N6O2S — CID 69264024
4-(4-aminophenyl)sulfanyl-N-[2-(2-methylphenoxy)propan-2-yl]-3-[(7-propan-2-ylpyrido[2,3-d]pyrimidin-4-yl)amino]benzamide (PubChem CID 69264024) has the molecular formula C33H34N6O2S and a molecular weight of 578.74 g/mol. Its IUPAC name is 4-(4-aminophenyl)sulfanyl-N-[2-(2-methylphenoxy)propan-2-yl]-3-[(7-propan-2-ylpyrido[2,3-d]pyrimidin-4-yl)amino]benzamide.
| Compound Name | 4-(4-aminophenyl)sulfanyl-N-[2-(2-methylphenoxy)propan-2-yl]-3-[(7-propan-2-ylpyrido[2,3-d]pyrimidin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 69264024 |
| Molecular Formula | C33H34N6O2S |
| Molecular Weight | 578.74 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | 4-(4-aminophenyl)sulfanyl-N-[2-(2-methylphenoxy)propan-2-yl]-3-[(7-propan-2-ylpyrido[2,3-d]pyrimidin-4-yl)amino]benzamide |
| SMILES | Cc1ccccc1OC(C)(C)NC(=O)c1ccc(Sc2ccc(N)cc2)c(Nc2ncnc3nc(C(C)C)ccc23)c1 |
| InChI | InChI=1S/C33H34N6O2S/c1-20(2)26-16-15-25-30(37-26)35-19-36-31(25)38-27-18-22(10-17-29(27)42-24-13-11-23(34)12-14-24)32(40)39-33(4,5)41-28-9-7-6-8-21(28)3/h6-20H,34H2,1-5H3,(H,39,40)(H,35,36,37,38) |
| InChIKey | KOMYWNYIFXFVSI-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.74 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|