C31H33N6O4PS — CID 69269039
[2-[4-(4-aminophenyl)sulfanyl-3-[(7-propan-2-ylpyrido[2,3-d]pyrimidin-4-yl)amino]anilino]-2-phenylpropyl] dihydrogen phosphate (PubChem CID 69269039) has the molecular formula C31H33N6O4PS and a molecular weight of 616.68 g/mol. Its IUPAC name is [2-[4-(4-aminophenyl)sulfanyl-3-[(7-propan-2-ylpyrido[2,3-d]pyrimidin-4-yl)amino]anilino]-2-phenylpropyl] dihydrogen phosphate.
| Compound Name | [2-[4-(4-aminophenyl)sulfanyl-3-[(7-propan-2-ylpyrido[2,3-d]pyrimidin-4-yl)amino]anilino]-2-phenylpropyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 69269039 |
| Molecular Formula | C31H33N6O4PS |
| Molecular Weight | 616.68 g/mol |
| Exact Mass | 616.20 |
| IUPAC Name | [2-[4-(4-aminophenyl)sulfanyl-3-[(7-propan-2-ylpyrido[2,3-d]pyrimidin-4-yl)amino]anilino]-2-phenylpropyl] dihydrogen phosphate |
| SMILES | CC(C)c1ccc2c(Nc3cc(NC(C)(COP(=O)(O)O)c4ccccc4)ccc3Sc3ccc(N)cc3)ncnc2n1 |
| InChI | InChI=1S/C31H33N6O4PS/c1-20(2)26-15-14-25-29(35-26)33-19-34-30(25)36-27-17-23(11-16-28(27)43-24-12-9-22(32)10-13-24)37-31(3,18-41-42(38,39)40)21-7-5-4-6-8-21/h4-17,19-20,37H,18,32H2,1-3H3,(H2,38,39,40)(H,33,34,35,36) |
| InChIKey | ASZNEFJMODMJNW-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 155.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.68 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|