C18H34N2O4S — CID 69266327
tert-butyl-[(1-dec-9-enylcyclopropyl)sulfonylamino]carbamic acid (PubChem CID 69266327) has the molecular formula C18H34N2O4S and a molecular weight of 374.55 g/mol. Its IUPAC name is tert-butyl-[(1-dec-9-enylcyclopropyl)sulfonylamino]carbamic acid.
| Compound Name | tert-butyl-[(1-dec-9-enylcyclopropyl)sulfonylamino]carbamic acid |
|---|---|
| PubChem CID | 69266327 |
| Molecular Formula | C18H34N2O4S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | tert-butyl-[(1-dec-9-enylcyclopropyl)sulfonylamino]carbamic acid |
| SMILES | C=CCCCCCCCCC1(S(=O)(=O)NN(C(=O)O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C18H34N2O4S/c1-5-6-7-8-9-10-11-12-13-18(14-15-18)25(23,24)19-20(16(21)22)17(2,3)4/h5,19H,1,6-15H2,2-4H3,(H,21,22) |
| InChIKey | CRLYRBDICVICRZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|