C17H34N2O4S — CID 69266724
tert-butylcarbamic acid;1-non-8-enylcyclopropane-1-sulfonamide (PubChem CID 69266724) has the molecular formula C17H34N2O4S and a molecular weight of 362.54 g/mol. Its IUPAC name is tert-butylcarbamic acid;1-non-8-enylcyclopropane-1-sulfonamide.
| Compound Name | tert-butylcarbamic acid;1-non-8-enylcyclopropane-1-sulfonamide |
|---|---|
| PubChem CID | 69266724 |
| Molecular Formula | C17H34N2O4S |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | tert-butylcarbamic acid;1-non-8-enylcyclopropane-1-sulfonamide |
| SMILES | C=CCCCCCCCC1(S(N)(=O)=O)CC1.CC(C)(C)NC(=O)O |
| InChI | InChI=1S/C12H23NO2S.C5H11NO2/c1-2-3-4-5-6-7-8-9-12(10-11-12)16(13,14)15;1-5(2,3)6-4(7)8/h2H,1,3-11H2,(H2,13,14,15);6H,1-3H3,(H,7,8) |
| InChIKey | WOQHHJJOBLMDDY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|