About tert-butylcarbamic acid;1-(2-hydroxypropan-2-yl)cyclopropane-1-sulfonamide
tert-butylcarbamic acid;1-(2-hydroxypropan-2-yl)cyclopropane-1-sulfonamide (PubChem CID 69266521) has the molecular formula C11H24N2O5S
and a molecular weight of 296.39 g/mol. Its IUPAC name is tert-butylcarbamic acid;1-(2-hydroxypropan-2-yl)cyclopropane-1-sulfonamide.
Molecular Properties
| Compound Name | tert-butylcarbamic acid;1-(2-hydroxypropan-2-yl)cyclopropane-1-sulfonamide |
| PubChem CID | 69266521 |
| Molecular Formula | C11H24N2O5S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | tert-butylcarbamic acid;1-(2-hydroxypropan-2-yl)cyclopropane-1-sulfonamide |
| SMILES | CC(C)(C)NC(=O)O.CC(C)(O)C1(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C6H13NO3S.C5H11NO2/c1-5(2,8)6(3-4-6)11(7,9)10;1-5(2,3)6-4(7)8/h8H,3-4H2,1-2H3,(H2,7,9,10);6H,1-3H3,(H,7,8) |
| InChIKey | QCWGQNAEHBYHTC-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butylcarbamic acid;1-(2-hydroxypropan-2-yl)cyclopropane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylcarbamic acid;1-(2-hydroxypropan-2-yl)cyclopropane-1-sulfonamide?
The IUPAC name of tert-butylcarbamic acid;1-(2-hydroxypropan-2-yl)cyclopropane-1-sulfonamide (CID 69266521) is tert-butylcarbamic acid;1-(2-hydroxypropan-2-yl)cyclopropane-1-sulfonamide.
What is the SMILES notation for tert-butylcarbamic acid;1-(2-hydroxypropan-2-yl)cyclopropane-1-sulfonamide?
The canonical SMILES for tert-butylcarbamic acid;1-(2-hydroxypropan-2-yl)cyclopropane-1-sulfonamide is CC(C)(C)NC(=O)O.CC(C)(O)C1(S(N)(=O)=O)CC1.
What is the InChIKey of tert-butylcarbamic acid;1-(2-hydroxypropan-2-yl)cyclopropane-1-sulfonamide?
The InChIKey is QCWGQNAEHBYHTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO3S.C5H11NO2/c1-5(2,8)6(3-4-6)11(7,9)10;1-5(2,3)6-4(7)8/h8H,3-4H2,1-2H3,(H2,7,9,10);6H,1-3H3,(H,7,8).
What are the key properties of tert-butylcarbamic acid;1-(2-hydroxypropan-2-yl)cyclopropane-1-sulfonamide?
tert-butylcarbamic acid;1-(2-hydroxypropan-2-yl)cyclopropane-1-sulfonamide has a molecular weight of 296.39 g/mol, XLogP of 0.63, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylcarbamic acid;1-(2-hydroxypropan-2-yl)cyclopropane-1-sulfonamide is sourced from PubChem (CID 69266521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).