C13H26N2O4S — CID 69264776
tert-butylcarbamic acid;1-(cyclobutylmethyl)cyclopropane-1-sulfonamide (PubChem CID 69264776) has the molecular formula C13H26N2O4S and a molecular weight of 306.43 g/mol. Its IUPAC name is tert-butylcarbamic acid;1-(cyclobutylmethyl)cyclopropane-1-sulfonamide.
| Compound Name | tert-butylcarbamic acid;1-(cyclobutylmethyl)cyclopropane-1-sulfonamide |
|---|---|
| PubChem CID | 69264776 |
| Molecular Formula | C13H26N2O4S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | tert-butylcarbamic acid;1-(cyclobutylmethyl)cyclopropane-1-sulfonamide |
| SMILES | CC(C)(C)NC(=O)O.NS(=O)(=O)C1(CC2CCC2)CC1 |
| InChI | InChI=1S/C8H15NO2S.C5H11NO2/c9-12(10,11)8(4-5-8)6-7-2-1-3-7;1-5(2,3)6-4(7)8/h7H,1-6H2,(H2,9,10,11);6H,1-3H3,(H,7,8) |
| InChIKey | ALDPOAVCNOCLER-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |