C18H25N2O3- — CID 6926722
3,3-dimethyl-5-oxo-5-(2-piperidin-1-ylanilino)pentanoate (PubChem CID 6926722) has the molecular formula C18H25N2O3- and a molecular weight of 317.41 g/mol. Its IUPAC name is 3,3-dimethyl-5-oxo-5-(2-piperidin-1-ylanilino)pentanoate.
| Compound Name | 3,3-dimethyl-5-oxo-5-(2-piperidin-1-ylanilino)pentanoate |
|---|---|
| PubChem CID | 6926722 |
| Molecular Formula | C18H25N2O3- |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 3,3-dimethyl-5-oxo-5-(2-piperidin-1-ylanilino)pentanoate |
| SMILES | CC(C)(CC(=O)[O-])CC(=O)Nc1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C18H26N2O3/c1-18(2,13-17(22)23)12-16(21)19-14-8-4-5-9-15(14)20-10-6-3-7-11-20/h4-5,8-9H,3,6-7,10-13H2,1-2H3,(H,19,21)(H,22,23)/p-1 |
| InChIKey | ZRWHJXWOTJWLCY-UHFFFAOYSA-M |
| XLogP | 2.17 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |