About 6-methoxy-8-(4-methyl-1,4-diazepan-1-yl)-4-oxochromene-2-carboxylic acid;hydrochloride
6-methoxy-8-(4-methyl-1,4-diazepan-1-yl)-4-oxochromene-2-carboxylic acid;hydrochloride (PubChem CID 69269151) has the molecular formula C17H21ClN2O5
and a molecular weight of 368.82 g/mol. Its IUPAC name is 6-methoxy-8-(4-methyl-1,4-diazepan-1-yl)-4-oxochromene-2-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 6-methoxy-8-(4-methyl-1,4-diazepan-1-yl)-4-oxochromene-2-carboxylic acid;hydrochloride |
| PubChem CID | 69269151 |
| Molecular Formula | C17H21ClN2O5 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 6-methoxy-8-(4-methyl-1,4-diazepan-1-yl)-4-oxochromene-2-carboxylic acid;hydrochloride |
| SMILES | COc1cc(N2CCCN(C)CC2)c2oc(C(=O)O)cc(=O)c2c1.Cl |
| InChI | InChI=1S/C17H20N2O5.ClH/c1-18-4-3-5-19(7-6-18)13-9-11(23-2)8-12-14(20)10-15(17(21)22)24-16(12)13;/h8-10H,3-7H2,1-2H3,(H,21,22);1H |
| InChIKey | CQZSAKBSNRGFPI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-methoxy-8-(4-methyl-1,4-diazepan-1-yl)-4-oxochromene-2-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-8-(4-methyl-1,4-diazepan-1-yl)-4-oxochromene-2-carboxylic acid;hydrochloride?
The IUPAC name of 6-methoxy-8-(4-methyl-1,4-diazepan-1-yl)-4-oxochromene-2-carboxylic acid;hydrochloride (CID 69269151) is 6-methoxy-8-(4-methyl-1,4-diazepan-1-yl)-4-oxochromene-2-carboxylic acid;hydrochloride.
What is the SMILES notation for 6-methoxy-8-(4-methyl-1,4-diazepan-1-yl)-4-oxochromene-2-carboxylic acid;hydrochloride?
The canonical SMILES for 6-methoxy-8-(4-methyl-1,4-diazepan-1-yl)-4-oxochromene-2-carboxylic acid;hydrochloride is COc1cc(N2CCCN(C)CC2)c2oc(C(=O)O)cc(=O)c2c1.Cl.
What is the InChIKey of 6-methoxy-8-(4-methyl-1,4-diazepan-1-yl)-4-oxochromene-2-carboxylic acid;hydrochloride?
The InChIKey is CQZSAKBSNRGFPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O5.ClH/c1-18-4-3-5-19(7-6-18)13-9-11(23-2)8-12-14(20)10-15(17(21)22)24-16(12)13;/h8-10H,3-7H2,1-2H3,(H,21,22);1H.
What are the key properties of 6-methoxy-8-(4-methyl-1,4-diazepan-1-yl)-4-oxochromene-2-carboxylic acid;hydrochloride?
6-methoxy-8-(4-methyl-1,4-diazepan-1-yl)-4-oxochromene-2-carboxylic acid;hydrochloride has a molecular weight of 368.82 g/mol, XLogP of 2.06, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-8-(4-methyl-1,4-diazepan-1-yl)-4-oxochromene-2-carboxylic acid;hydrochloride is sourced from PubChem (CID 69269151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).