C30H37N5O5 — CID 23533373
tert-butyl 4-[4-[[8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carbonyl]amino]phenyl]piperazine-1-carboxylate (PubChem CID 23533373) has the molecular formula C30H37N5O5 and a molecular weight of 547.66 g/mol. Its IUPAC name is tert-butyl 4-[4-[[8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carbonyl]amino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carbonyl]amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 23533373 |
| Molecular Formula | C30H37N5O5 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | tert-butyl 4-[4-[[8-(4-methylpiperazin-1-yl)-4-oxochromene-2-carbonyl]amino]phenyl]piperazine-1-carboxylate |
| SMILES | CN1CCN(c2cccc3c(=O)cc(C(=O)Nc4ccc(N5CCN(C(=O)OC(C)(C)C)CC5)cc4)oc23)CC1 |
| InChI | InChI=1S/C30H37N5O5/c1-30(2,3)40-29(38)35-18-16-33(17-19-35)22-10-8-21(9-11-22)31-28(37)26-20-25(36)23-6-5-7-24(27(23)39-26)34-14-12-32(4)13-15-34/h5-11,20H,12-19H2,1-4H3,(H,31,37) |
| InChIKey | QTCKSNJKKXIHNP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|