C21H29N3O4 — CID 69269928
1-(5-butanoyl-3-cyano-6-methoxy-2-pyridinyl)-2-tert-butylpiperidine-4-carboxylic acid (PubChem CID 69269928) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is 1-(5-butanoyl-3-cyano-6-methoxy-2-pyridinyl)-2-tert-butylpiperidine-4-carboxylic acid.
| Compound Name | 1-(5-butanoyl-3-cyano-6-methoxy-2-pyridinyl)-2-tert-butylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 69269928 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 1-(5-butanoyl-3-cyano-6-methoxy-2-pyridinyl)-2-tert-butylpiperidine-4-carboxylic acid |
| SMILES | CCCC(=O)c1cc(C#N)c(N2CCC(C(=O)O)CC2C(C)(C)C)nc1OC |
| InChI | InChI=1S/C21H29N3O4/c1-6-7-16(25)15-10-14(12-22)18(23-19(15)28-5)24-9-8-13(20(26)27)11-17(24)21(2,3)4/h10,13,17H,6-9,11H2,1-5H3,(H,26,27) |
| InChIKey | DPCASVWQLNWGOD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |