C15H20F2N2O5 — CID 69273987
(2R)-2-[(2,6-difluorophenyl)methyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-3-hydroxypropanoic acid (PubChem CID 69273987) has the molecular formula C15H20F2N2O5 and a molecular weight of 346.33 g/mol. Its IUPAC name is (2R)-2-[(2,6-difluorophenyl)methyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[(2,6-difluorophenyl)methyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 69273987 |
| Molecular Formula | C15H20F2N2O5 |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (2R)-2-[(2,6-difluorophenyl)methyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-3-hydroxypropanoic acid |
| SMILES | CC(C)(C)OC(=O)NN(Cc1c(F)cccc1F)[C@H](CO)C(=O)O |
| InChI | InChI=1S/C15H20F2N2O5/c1-15(2,3)24-14(23)18-19(12(8-20)13(21)22)7-9-10(16)5-4-6-11(9)17/h4-6,12,20H,7-8H2,1-3H3,(H,18,23)(H,21,22)/t12-/m1/s1 |
| InChIKey | JOZAJZSAAHOGFU-GFCCVEGCSA-N |
| XLogP | 1.65 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|