C10H15BrN2O2S — CID 69274920
N'-[2-(4-bromophenyl)sulfonylethyl]ethane-1,2-diamine (PubChem CID 69274920) has the molecular formula C10H15BrN2O2S and a molecular weight of 307.21 g/mol. Its IUPAC name is N'-[2-(4-bromophenyl)sulfonylethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-(4-bromophenyl)sulfonylethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 69274920 |
| Molecular Formula | C10H15BrN2O2S |
| Molecular Weight | 307.21 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | N'-[2-(4-bromophenyl)sulfonylethyl]ethane-1,2-diamine |
| SMILES | NCCNCCS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H15BrN2O2S/c11-9-1-3-10(4-2-9)16(14,15)8-7-13-6-5-12/h1-4,13H,5-8,12H2 |
| InChIKey | NCYAPYUDNZXILK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|