C12H19BrN2O2S — CID 114231205
N'-[2-(4-bromophenyl)sulfonylethyl]-N'-ethylethane-1,2-diamine (PubChem CID 114231205) has the molecular formula C12H19BrN2O2S and a molecular weight of 335.27 g/mol. Its IUPAC name is N'-[2-(4-bromophenyl)sulfonylethyl]-N'-ethylethane-1,2-diamine.
| Compound Name | N'-[2-(4-bromophenyl)sulfonylethyl]-N'-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 114231205 |
| Molecular Formula | C12H19BrN2O2S |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | N'-[2-(4-bromophenyl)sulfonylethyl]-N'-ethylethane-1,2-diamine |
| SMILES | CCN(CCN)CCS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H19BrN2O2S/c1-2-15(8-7-14)9-10-18(16,17)12-5-3-11(13)4-6-12/h3-6H,2,7-10,14H2,1H3 |
| InChIKey | VOZHHZLDFZUAST-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |