C13H21BrN2OS — CID 57157578
N-[(4-bromophenyl)-methylidene-oxo-λ6-sulfanyl]-N',N'-diethylethane-1,2-diamine (PubChem CID 57157578) has the molecular formula C13H21BrN2OS and a molecular weight of 333.30 g/mol. Its IUPAC name is N-[(4-bromophenyl)-methylidene-oxo-λ6-sulfanyl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[(4-bromophenyl)-methylidene-oxo-λ6-sulfanyl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 57157578 |
| Molecular Formula | C13H21BrN2OS |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | N-[(4-bromophenyl)-methylidene-oxo-λ6-sulfanyl]-N',N'-diethylethane-1,2-diamine |
| SMILES | C=S(=O)(NCCN(CC)CC)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H21BrN2OS/c1-4-16(5-2)11-10-15-18(3,17)13-8-6-12(14)7-9-13/h6-9H,3-5,10-11H2,1-2H3,(H,15,17) |
| InChIKey | YNTSNBXIGMTOIX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|