C10H15ClN2O — CID 69274969
N'-[2-(2-chlorophenoxy)ethyl]ethane-1,2-diamine (PubChem CID 69274969) has the molecular formula C10H15ClN2O and a molecular weight of 214.70 g/mol. Its IUPAC name is N'-[2-(2-chlorophenoxy)ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-(2-chlorophenoxy)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 69274969 |
| Molecular Formula | C10H15ClN2O |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | N'-[2-(2-chlorophenoxy)ethyl]ethane-1,2-diamine |
| SMILES | NCCNCCOc1ccccc1Cl |
| InChI | InChI=1S/C10H15ClN2O/c11-9-3-1-2-4-10(9)14-8-7-13-6-5-12/h1-4,13H,5-8,12H2 |
| InChIKey | UGUKPLCQGMQYGP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|