C10H17BrCl2N2O — CID 69275255
N'-[2-(2-bromophenoxy)ethyl]ethane-1,2-diamine;dihydrochloride (PubChem CID 69275255) has the molecular formula C10H17BrCl2N2O and a molecular weight of 332.07 g/mol. Its IUPAC name is N'-[2-(2-bromophenoxy)ethyl]ethane-1,2-diamine;dihydrochloride.
| Compound Name | N'-[2-(2-bromophenoxy)ethyl]ethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 69275255 |
| Molecular Formula | C10H17BrCl2N2O |
| Molecular Weight | 332.07 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | N'-[2-(2-bromophenoxy)ethyl]ethane-1,2-diamine;dihydrochloride |
| SMILES | Cl.Cl.NCCNCCOc1ccccc1Br |
| InChI | InChI=1S/C10H15BrN2O.2ClH/c11-9-3-1-2-4-10(9)14-8-7-13-6-5-12;;/h1-4,13H,5-8,12H2;2*1H |
| InChIKey | LRTIZWGBEGGIFC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.07 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|