C15H20ClN3O9 — CID 69275253
2-[2-(4-chloro-N-methylanilino)ethylamino]acetamide;oxalic acid (PubChem CID 69275253) has the molecular formula C15H20ClN3O9 and a molecular weight of 421.79 g/mol. Its IUPAC name is 2-[2-(4-chloro-N-methylanilino)ethylamino]acetamide;oxalic acid.
| Compound Name | 2-[2-(4-chloro-N-methylanilino)ethylamino]acetamide;oxalic acid |
|---|---|
| PubChem CID | 69275253 |
| Molecular Formula | C15H20ClN3O9 |
| Molecular Weight | 421.79 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 2-[2-(4-chloro-N-methylanilino)ethylamino]acetamide;oxalic acid |
| SMILES | CN(CCNCC(N)=O)c1ccc(Cl)cc1.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C11H16ClN3O.2C2H2O4/c1-15(7-6-14-8-11(13)16)10-4-2-9(12)3-5-10;2*3-1(4)2(5)6/h2-5,14H,6-8H2,1H3,(H2,13,16);2*(H,3,4)(H,5,6) |
| InChIKey | HKGNPVAMHRRIRO-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 207.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.79 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|