C22H25N3O2 — CID 69276574
2-[[3-tert-butyl-1-(2-ethylphenyl)pyrazol-5-yl]amino]benzoic acid (PubChem CID 69276574) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-[[3-tert-butyl-1-(2-ethylphenyl)pyrazol-5-yl]amino]benzoic acid.
| Compound Name | 2-[[3-tert-butyl-1-(2-ethylphenyl)pyrazol-5-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 69276574 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 2-[[3-tert-butyl-1-(2-ethylphenyl)pyrazol-5-yl]amino]benzoic acid |
| SMILES | CCc1ccccc1-n1nc(C(C)(C)C)cc1Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C22H25N3O2/c1-5-15-10-6-9-13-18(15)25-20(14-19(24-25)22(2,3)4)23-17-12-8-7-11-16(17)21(26)27/h6-14,23H,5H2,1-4H3,(H,26,27) |
| InChIKey | WEBPLISIMPAUFP-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |