C16H21N3O2S — CID 69277054
2-[(3-tert-butyl-1-methylpyrazol-5-yl)amino]-5-methylsulfanylbenzoic acid (PubChem CID 69277054) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 2-[(3-tert-butyl-1-methylpyrazol-5-yl)amino]-5-methylsulfanylbenzoic acid.
| Compound Name | 2-[(3-tert-butyl-1-methylpyrazol-5-yl)amino]-5-methylsulfanylbenzoic acid |
|---|---|
| PubChem CID | 69277054 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-[(3-tert-butyl-1-methylpyrazol-5-yl)amino]-5-methylsulfanylbenzoic acid |
| SMILES | CSc1ccc(Nc2cc(C(C)(C)C)nn2C)c(C(=O)O)c1 |
| InChI | InChI=1S/C16H21N3O2S/c1-16(2,3)13-9-14(19(4)18-13)17-12-7-6-10(22-5)8-11(12)15(20)21/h6-9,17H,1-5H3,(H,20,21) |
| InChIKey | HBSPDESJKCIONN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |