C20H31ClN2O4 — CID 69277133
tert-butyl N-[[2-(1-chloroethoxycarbonylamino)phenyl]methyl]-N-pentan-3-ylcarbamate (PubChem CID 69277133) has the molecular formula C20H31ClN2O4 and a molecular weight of 398.93 g/mol. Its IUPAC name is tert-butyl N-[[2-(1-chloroethoxycarbonylamino)phenyl]methyl]-N-pentan-3-ylcarbamate.
| Compound Name | tert-butyl N-[[2-(1-chloroethoxycarbonylamino)phenyl]methyl]-N-pentan-3-ylcarbamate |
|---|---|
| PubChem CID | 69277133 |
| Molecular Formula | C20H31ClN2O4 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | tert-butyl N-[[2-(1-chloroethoxycarbonylamino)phenyl]methyl]-N-pentan-3-ylcarbamate |
| SMILES | CCC(CC)N(Cc1ccccc1NC(=O)OC(C)Cl)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H31ClN2O4/c1-7-16(8-2)23(19(25)27-20(4,5)6)13-15-11-9-10-12-17(15)22-18(24)26-14(3)21/h9-12,14,16H,7-8,13H2,1-6H3,(H,22,24) |
| InChIKey | NOYSEQNZZYYERY-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|