C32H36N2O3Sn — CID 69278325
1,1-dimethyl-3-(4-propan-2-ylphenyl)urea;triphenylstannyl acetate (PubChem CID 69278325) has the molecular formula C32H36N2O3Sn and a molecular weight of 615.36 g/mol. Its IUPAC name is 1,1-dimethyl-3-(4-propan-2-ylphenyl)urea;triphenylstannyl acetate.
| Compound Name | 1,1-dimethyl-3-(4-propan-2-ylphenyl)urea;triphenylstannyl acetate |
|---|---|
| PubChem CID | 69278325 |
| Molecular Formula | C32H36N2O3Sn |
| Molecular Weight | 615.36 g/mol |
| Exact Mass | 616.17 |
| IUPAC Name | 1,1-dimethyl-3-(4-propan-2-ylphenyl)urea;triphenylstannyl acetate |
| SMILES | CC(=O)O[Sn](c1ccccc1)(c1ccccc1)c1ccccc1.CC(C)c1ccc(NC(=O)N(C)C)cc1 |
| InChI | InChI=1S/C12H18N2O.3C6H5.C2H4O2.Sn/c1-9(2)10-5-7-11(8-6-10)13-12(15)14(3)4;3*1-2-4-6-5-3-1;1-2(3)4;/h5-9H,1-4H3,(H,13,15);3*1-5H;1H3,(H,3,4);/q;;;;;+1/p-1 |
| InChIKey | RKHMRFBMKKTNAW-UHFFFAOYSA-M |
| XLogP | 5.12 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |