C20H33NO2 — CID 69279574
tert-butyl N-[[2-methyl-4-(2-methylpropyl)-5-propan-2-ylphenyl]methyl]carbamate (PubChem CID 69279574) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is tert-butyl N-[[2-methyl-4-(2-methylpropyl)-5-propan-2-ylphenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-methyl-4-(2-methylpropyl)-5-propan-2-ylphenyl]methyl]carbamate |
|---|---|
| PubChem CID | 69279574 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | tert-butyl N-[[2-methyl-4-(2-methylpropyl)-5-propan-2-ylphenyl]methyl]carbamate |
| SMILES | Cc1cc(CC(C)C)c(C(C)C)cc1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H33NO2/c1-13(2)9-16-10-15(5)17(11-18(16)14(3)4)12-21-19(22)23-20(6,7)8/h10-11,13-14H,9,12H2,1-8H3,(H,21,22) |
| InChIKey | LZTLNOWZVSRGMB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |