About piperidine-1-carboxylic acid;[(3S)-piperidin-3-yl]methanol
piperidine-1-carboxylic acid;[(3S)-piperidin-3-yl]methanol (PubChem CID 69280006) has the molecular formula C12H24N2O3
and a molecular weight of 244.33 g/mol. Its IUPAC name is piperidine-1-carboxylic acid;[(3S)-piperidin-3-yl]methanol.
Molecular Properties
| Compound Name | piperidine-1-carboxylic acid;[(3S)-piperidin-3-yl]methanol |
| PubChem CID | 69280006 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | piperidine-1-carboxylic acid;[(3S)-piperidin-3-yl]methanol |
| SMILES | O=C(O)N1CCCCC1.OC[C@H]1CCCNC1 |
| InChI | InChI=1S/C6H11NO2.C6H13NO/c8-6(9)7-4-2-1-3-5-7;8-5-6-2-1-3-7-4-6/h1-5H2,(H,8,9);6-8H,1-5H2/t;6-/m.0/s1 |
| InChIKey | LXZDGCIAMLWXLU-ZCMDIHMWSA-N |
| XLogP | 1.13 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperidine-1-carboxylic acid;[(3S)-piperidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine-1-carboxylic acid;[(3S)-piperidin-3-yl]methanol?
The IUPAC name of piperidine-1-carboxylic acid;[(3S)-piperidin-3-yl]methanol (CID 69280006) is piperidine-1-carboxylic acid;[(3S)-piperidin-3-yl]methanol.
What is the SMILES notation for piperidine-1-carboxylic acid;[(3S)-piperidin-3-yl]methanol?
The canonical SMILES for piperidine-1-carboxylic acid;[(3S)-piperidin-3-yl]methanol is O=C(O)N1CCCCC1.OC[C@H]1CCCNC1.
What is the InChIKey of piperidine-1-carboxylic acid;[(3S)-piperidin-3-yl]methanol?
The InChIKey is LXZDGCIAMLWXLU-ZCMDIHMWSA-N. The full InChI is InChI=1S/C6H11NO2.C6H13NO/c8-6(9)7-4-2-1-3-5-7;8-5-6-2-1-3-7-4-6/h1-5H2,(H,8,9);6-8H,1-5H2/t;6-/m.0/s1.
What are the key properties of piperidine-1-carboxylic acid;[(3S)-piperidin-3-yl]methanol?
piperidine-1-carboxylic acid;[(3S)-piperidin-3-yl]methanol has a molecular weight of 244.33 g/mol, XLogP of 1.13, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine-1-carboxylic acid;[(3S)-piperidin-3-yl]methanol is sourced from PubChem (CID 69280006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).