C27H23N5O3S — CID 69280449
N-[4-[4-amino-7-(3-amino-3-oxoprop-1-enyl)thieno[3,2-c]pyridin-3-yl]-2-methoxyphenyl]-1-methylindole-2-carboxamide (PubChem CID 69280449) has the molecular formula C27H23N5O3S and a molecular weight of 497.58 g/mol. Its IUPAC name is N-[4-[4-amino-7-(3-amino-3-oxoprop-1-enyl)thieno[3,2-c]pyridin-3-yl]-2-methoxyphenyl]-1-methylindole-2-carboxamide.
| Compound Name | N-[4-[4-amino-7-(3-amino-3-oxoprop-1-enyl)thieno[3,2-c]pyridin-3-yl]-2-methoxyphenyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 69280449 |
| Molecular Formula | C27H23N5O3S |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | N-[4-[4-amino-7-(3-amino-3-oxoprop-1-enyl)thieno[3,2-c]pyridin-3-yl]-2-methoxyphenyl]-1-methylindole-2-carboxamide |
| SMILES | COc1cc(-c2csc3c(C=CC(N)=O)cnc(N)c23)ccc1NC(=O)c1cc2ccccc2n1C |
| InChI | InChI=1S/C27H23N5O3S/c1-32-20-6-4-3-5-16(20)11-21(32)27(34)31-19-9-7-15(12-22(19)35-2)18-14-36-25-17(8-10-23(28)33)13-30-26(29)24(18)25/h3-14H,1-2H3,(H2,28,33)(H2,29,30)(H,31,34) |
| InChIKey | OFAXDINKUHRRHD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 125.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|