C31H32N6O3S — CID 69283844
N-[4-[4-amino-7-[3-[3-(methylamino)propylamino]-3-oxoprop-1-enyl]thieno[3,2-c]pyridin-3-yl]-2-methoxyphenyl]-1-methylindole-2-carboxamide (PubChem CID 69283844) has the molecular formula C31H32N6O3S and a molecular weight of 568.70 g/mol. Its IUPAC name is N-[4-[4-amino-7-[3-[3-(methylamino)propylamino]-3-oxoprop-1-enyl]thieno[3,2-c]pyridin-3-yl]-2-methoxyphenyl]-1-methylindole-2-carboxamide.
| Compound Name | N-[4-[4-amino-7-[3-[3-(methylamino)propylamino]-3-oxoprop-1-enyl]thieno[3,2-c]pyridin-3-yl]-2-methoxyphenyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 69283844 |
| Molecular Formula | C31H32N6O3S |
| Molecular Weight | 568.70 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | N-[4-[4-amino-7-[3-[3-(methylamino)propylamino]-3-oxoprop-1-enyl]thieno[3,2-c]pyridin-3-yl]-2-methoxyphenyl]-1-methylindole-2-carboxamide |
| SMILES | CNCCCNC(=O)C=Cc1cnc(N)c2c(-c3ccc(NC(=O)c4cc5ccccc5n4C)c(OC)c3)csc12 |
| InChI | InChI=1S/C31H32N6O3S/c1-33-13-6-14-34-27(38)12-10-21-17-35-30(32)28-22(18-41-29(21)28)19-9-11-23(26(16-19)40-3)36-31(39)25-15-20-7-4-5-8-24(20)37(25)2/h4-5,7-12,15-18,33H,6,13-14H2,1-3H3,(H2,32,35)(H,34,38)(H,36,39) |
| InChIKey | MALAZNAYKGNPKM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 123.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.70 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|