C21H17FN2O3 — CID 69281889
(4R,5R)-4-[3-(6-fluoro-3-pyridinyl)phenyl]-5-(3-methoxyphenyl)-1,3-oxazolidin-2-one (PubChem CID 69281889) has the molecular formula C21H17FN2O3 and a molecular weight of 364.38 g/mol. Its IUPAC name is (4R,5R)-4-[3-(6-fluoro-3-pyridinyl)phenyl]-5-(3-methoxyphenyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R,5R)-4-[3-(6-fluoro-3-pyridinyl)phenyl]-5-(3-methoxyphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 69281889 |
| Molecular Formula | C21H17FN2O3 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (4R,5R)-4-[3-(6-fluoro-3-pyridinyl)phenyl]-5-(3-methoxyphenyl)-1,3-oxazolidin-2-one |
| SMILES | COc1cccc([C@H]2OC(=O)N[C@@H]2c2cccc(-c3ccc(F)nc3)c2)c1 |
| InChI | InChI=1S/C21H17FN2O3/c1-26-17-7-3-6-15(11-17)20-19(24-21(25)27-20)14-5-2-4-13(10-14)16-8-9-18(22)23-12-16/h2-12,19-20H,1H3,(H,24,25)/t19-,20-/m1/s1 |
| InChIKey | JGPDEWNQXBQHRA-WOJBJXKFSA-N |
| XLogP | 4.42 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|