C23H17FN2O3 — CID 69093599
(4R,5R)-4-[3-[2-(3-fluoro-2-pyridinyl)ethynyl]phenyl]-5-(3-methoxyphenyl)-1,3-oxazolidin-2-one (PubChem CID 69093599) has the molecular formula C23H17FN2O3 and a molecular weight of 388.40 g/mol. Its IUPAC name is (4R,5R)-4-[3-[2-(3-fluoro-2-pyridinyl)ethynyl]phenyl]-5-(3-methoxyphenyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R,5R)-4-[3-[2-(3-fluoro-2-pyridinyl)ethynyl]phenyl]-5-(3-methoxyphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 69093599 |
| Molecular Formula | C23H17FN2O3 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | (4R,5R)-4-[3-[2-(3-fluoro-2-pyridinyl)ethynyl]phenyl]-5-(3-methoxyphenyl)-1,3-oxazolidin-2-one |
| SMILES | COc1cccc([C@H]2OC(=O)N[C@@H]2c2cccc(C#Cc3ncccc3F)c2)c1 |
| InChI | InChI=1S/C23H17FN2O3/c1-28-18-8-3-7-17(14-18)22-21(26-23(27)29-22)16-6-2-5-15(13-16)10-11-20-19(24)9-4-12-25-20/h2-9,12-14,21-22H,1H3,(H,26,27)/t21-,22-/m1/s1 |
| InChIKey | IHNJLNXROBJAFV-FGZHOGPDSA-N |
| XLogP | 4.15 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|