C22H16N2O2 — CID 69081725
4-[3-(2-phenylethynyl)phenyl]-5-pyridin-3-yl-1,3-oxazolidin-2-one (PubChem CID 69081725) has the molecular formula C22H16N2O2 and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-[3-(2-phenylethynyl)phenyl]-5-pyridin-3-yl-1,3-oxazolidin-2-one.
| Compound Name | 4-[3-(2-phenylethynyl)phenyl]-5-pyridin-3-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 69081725 |
| Molecular Formula | C22H16N2O2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 4-[3-(2-phenylethynyl)phenyl]-5-pyridin-3-yl-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(c2cccc(C#Cc3ccccc3)c2)C(c2cccnc2)O1 |
| InChI | InChI=1S/C22H16N2O2/c25-22-24-20(21(26-22)19-10-5-13-23-15-19)18-9-4-8-17(14-18)12-11-16-6-2-1-3-7-16/h1-10,13-15,20-21H,(H,24,25) |
| InChIKey | MNEWPFGQLYQEHL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|