C24H16N4O3 — CID 69282171
(4R,5S)-4-[3-(2-phenylethynyl)phenyl]-5-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3-oxazolidin-2-one (PubChem CID 69282171) has the molecular formula C24H16N4O3 and a molecular weight of 408.42 g/mol. Its IUPAC name is (4R,5S)-4-[3-(2-phenylethynyl)phenyl]-5-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-4-[3-(2-phenylethynyl)phenyl]-5-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 69282171 |
| Molecular Formula | C24H16N4O3 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | (4R,5S)-4-[3-(2-phenylethynyl)phenyl]-5-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@H](c2cccc(C#Cc3ccccc3)c2)[C@@H](c2nc(-c3cccnc3)no2)O1 |
| InChI | InChI=1S/C24H16N4O3/c29-24-26-20(18-9-4-8-17(14-18)12-11-16-6-2-1-3-7-16)21(30-24)23-27-22(28-31-23)19-10-5-13-25-15-19/h1-10,13-15,20-21H,(H,26,29)/t20-,21+/m1/s1 |
| InChIKey | NRCWYJZKFKYUCQ-RTWAWAEBSA-N |
| XLogP | 4.05 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|