C21H19N3O3 — CID 163526660
(4S,5R)-4-[3-[2-(3-methylcyclohexa-1,5-dien-1-yl)ethynyl]phenyl]-5-(3-methyl-1,2,4-oxadiazol-5-yl)-1,3-oxazolidin-2-one (PubChem CID 163526660) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is (4S,5R)-4-[3-[2-(3-methylcyclohexa-1,5-dien-1-yl)ethynyl]phenyl]-5-(3-methyl-1,2,4-oxadiazol-5-yl)-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-4-[3-[2-(3-methylcyclohexa-1,5-dien-1-yl)ethynyl]phenyl]-5-(3-methyl-1,2,4-oxadiazol-5-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 163526660 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | (4S,5R)-4-[3-[2-(3-methylcyclohexa-1,5-dien-1-yl)ethynyl]phenyl]-5-(3-methyl-1,2,4-oxadiazol-5-yl)-1,3-oxazolidin-2-one |
| SMILES | Cc1noc([C@@H]2OC(=O)N[C@H]2c2cccc(C#CC3=CC(C)CC=C3)c2)n1 |
| InChI | InChI=1S/C21H19N3O3/c1-13-5-3-6-15(11-13)9-10-16-7-4-8-17(12-16)18-19(26-21(25)23-18)20-22-14(2)24-27-20/h3-4,6-8,11-13,18-19H,5H2,1-2H3,(H,23,25)/t13?,18-,19+/m0/s1 |
| InChIKey | DPIZMZRVBDXTOG-WFELRXAXSA-N |
| XLogP | 3.77 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|