C23H19ClF2N2O5S2 — CID 69281993
2-chloro-3,6-difluoro-N-[1-(4-methylsulfonylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-yl]benzamide (PubChem CID 69281993) has the molecular formula C23H19ClF2N2O5S2 and a molecular weight of 541.00 g/mol. Its IUPAC name is 2-chloro-3,6-difluoro-N-[1-(4-methylsulfonylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-yl]benzamide.
| Compound Name | 2-chloro-3,6-difluoro-N-[1-(4-methylsulfonylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-yl]benzamide |
|---|---|
| PubChem CID | 69281993 |
| Molecular Formula | C23H19ClF2N2O5S2 |
| Molecular Weight | 541.00 g/mol |
| Exact Mass | 540.04 |
| IUPAC Name | 2-chloro-3,6-difluoro-N-[1-(4-methylsulfonylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-yl]benzamide |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)N2CCCc3ccc(NC(=O)c4c(F)ccc(F)c4Cl)cc32)cc1 |
| InChI | InChI=1S/C23H19ClF2N2O5S2/c1-34(30,31)16-6-8-17(9-7-16)35(32,33)28-12-2-3-14-4-5-15(13-20(14)28)27-23(29)21-18(25)10-11-19(26)22(21)24/h4-11,13H,2-3,12H2,1H3,(H,27,29) |
| InChIKey | XYBFSZOOLKIIES-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.00 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|