C21H17ClFN3O3S — CID 90088378
2-chloro-N-[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-yl]pyridine-4-carboxamide (PubChem CID 90088378) has the molecular formula C21H17ClFN3O3S and a molecular weight of 445.90 g/mol. Its IUPAC name is 2-chloro-N-[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-yl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 90088378 |
| Molecular Formula | C21H17ClFN3O3S |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 2-chloro-N-[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-yl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)N(S(=O)(=O)c1ccc(F)cc1)CCC2)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C21H17ClFN3O3S/c22-20-12-15(9-10-24-20)21(27)25-17-6-3-14-2-1-11-26(19(14)13-17)30(28,29)18-7-4-16(23)5-8-18/h3-10,12-13H,1-2,11H2,(H,25,27) |
| InChIKey | URFXXJDJBPXUPW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|