C21H12Cl2F3N3O3S — CID 69282264
2-chloro-N-[1-(3-chlorophenyl)sulfonylindazol-6-yl]-6-(trifluoromethyl)benzamide (PubChem CID 69282264) has the molecular formula C21H12Cl2F3N3O3S and a molecular weight of 514.31 g/mol. Its IUPAC name is 2-chloro-N-[1-(3-chlorophenyl)sulfonylindazol-6-yl]-6-(trifluoromethyl)benzamide.
| Compound Name | 2-chloro-N-[1-(3-chlorophenyl)sulfonylindazol-6-yl]-6-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 69282264 |
| Molecular Formula | C21H12Cl2F3N3O3S |
| Molecular Weight | 514.31 g/mol |
| Exact Mass | 512.99 |
| IUPAC Name | 2-chloro-N-[1-(3-chlorophenyl)sulfonylindazol-6-yl]-6-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccc2cnn(S(=O)(=O)c3cccc(Cl)c3)c2c1)c1c(Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C21H12Cl2F3N3O3S/c22-13-3-1-4-15(9-13)33(31,32)29-18-10-14(8-7-12(18)11-27-29)28-20(30)19-16(21(24,25)26)5-2-6-17(19)23/h1-11H,(H,28,30) |
| InChIKey | JFLXEBGCXYFLKN-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.31 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |