C21H21FN6O4S — CID 69283079
4-[[4-[4-(2-cyanoethoxy)-3-methylanilino]-5-fluoropyrimidin-2-yl]amino]-2-methoxybenzenesulfonamide (PubChem CID 69283079) has the molecular formula C21H21FN6O4S and a molecular weight of 472.50 g/mol. Its IUPAC name is 4-[[4-[4-(2-cyanoethoxy)-3-methylanilino]-5-fluoropyrimidin-2-yl]amino]-2-methoxybenzenesulfonamide.
| Compound Name | 4-[[4-[4-(2-cyanoethoxy)-3-methylanilino]-5-fluoropyrimidin-2-yl]amino]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 69283079 |
| Molecular Formula | C21H21FN6O4S |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 4-[[4-[4-(2-cyanoethoxy)-3-methylanilino]-5-fluoropyrimidin-2-yl]amino]-2-methoxybenzenesulfonamide |
| SMILES | COc1cc(Nc2ncc(F)c(Nc3ccc(OCCC#N)c(C)c3)n2)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C21H21FN6O4S/c1-13-10-14(4-6-17(13)32-9-3-8-23)26-20-16(22)12-25-21(28-20)27-15-5-7-19(33(24,29)30)18(11-15)31-2/h4-7,10-12H,3,9H2,1-2H3,(H2,24,29,30)(H2,25,26,27,28) |
| InChIKey | SPDWBSSMCXHIGS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 152.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|