C15H18F3NO4S — CID 69283923
4-[methyl-[4-(trifluoromethyl)phenyl]sulfonylamino]cyclohexane-1-carboxylic acid (PubChem CID 69283923) has the molecular formula C15H18F3NO4S and a molecular weight of 365.37 g/mol. Its IUPAC name is 4-[methyl-[4-(trifluoromethyl)phenyl]sulfonylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[methyl-[4-(trifluoromethyl)phenyl]sulfonylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 69283923 |
| Molecular Formula | C15H18F3NO4S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 4-[methyl-[4-(trifluoromethyl)phenyl]sulfonylamino]cyclohexane-1-carboxylic acid |
| SMILES | CN(C1CCC(C(=O)O)CC1)S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H18F3NO4S/c1-19(12-6-2-10(3-7-12)14(20)21)24(22,23)13-8-4-11(5-9-13)15(16,17)18/h4-5,8-10,12H,2-3,6-7H2,1H3,(H,20,21) |
| InChIKey | OGZAXBFTDBEQAU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |