C14H21ClN2O2 — CID 69285326
2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl-trimethylazanium chloride (PubChem CID 69285326) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl-trimethylazanium chloride.
| Compound Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl-trimethylazanium chloride |
|---|---|
| PubChem CID | 69285326 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl-trimethylazanium chloride |
| SMILES | C[N+](C)(C)CCN1C(=O)C2C3C=CC(C3)C2C1=O.[Cl-] |
| InChI | InChI=1S/C14H21N2O2.ClH/c1-16(2,3)7-6-15-13(17)11-9-4-5-10(8-9)12(11)14(15)18;/h4-5,9-12H,6-8H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | NUEGWDAEIZGLEH-UHFFFAOYSA-M |
| XLogP | -2.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|