C15H30N2O4S — CID 69285493
[4-(tert-butylamino)cyclohexyl]-(propan-2-ylsulfonylmethyl)carbamic acid (PubChem CID 69285493) has the molecular formula C15H30N2O4S and a molecular weight of 334.48 g/mol. Its IUPAC name is [4-(tert-butylamino)cyclohexyl]-(propan-2-ylsulfonylmethyl)carbamic acid.
| Compound Name | [4-(tert-butylamino)cyclohexyl]-(propan-2-ylsulfonylmethyl)carbamic acid |
|---|---|
| PubChem CID | 69285493 |
| Molecular Formula | C15H30N2O4S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | [4-(tert-butylamino)cyclohexyl]-(propan-2-ylsulfonylmethyl)carbamic acid |
| SMILES | CC(C)S(=O)(=O)CN(C(=O)O)C1CCC(NC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H30N2O4S/c1-11(2)22(20,21)10-17(14(18)19)13-8-6-12(7-9-13)16-15(3,4)5/h11-13,16H,6-10H2,1-5H3,(H,18,19) |
| InChIKey | YLDJSBJKQBXFPK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |