C13H25N3O2S — CID 87782305
[4-(carbamothioylamino)cyclohexyl]-(2,2-dimethylpropyl)carbamic acid (PubChem CID 87782305) has the molecular formula C13H25N3O2S and a molecular weight of 287.43 g/mol. Its IUPAC name is [4-(carbamothioylamino)cyclohexyl]-(2,2-dimethylpropyl)carbamic acid.
| Compound Name | [4-(carbamothioylamino)cyclohexyl]-(2,2-dimethylpropyl)carbamic acid |
|---|---|
| PubChem CID | 87782305 |
| Molecular Formula | C13H25N3O2S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | [4-(carbamothioylamino)cyclohexyl]-(2,2-dimethylpropyl)carbamic acid |
| SMILES | CC(C)(C)CN(C(=O)O)C1CCC(NC(N)=S)CC1 |
| InChI | InChI=1S/C13H25N3O2S/c1-13(2,3)8-16(12(17)18)10-6-4-9(5-7-10)15-11(14)19/h9-10H,4-8H2,1-3H3,(H,17,18)(H3,14,15,19) |
| InChIKey | SAKMNJJPTPWQPY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|