C20H29ClN2O4 — CID 89388746
[4-[(3-chloro-2,2-dimethylpropanoyl)-[(4-methoxyphenyl)methyl]amino]cyclohexyl]carbamic acid (PubChem CID 89388746) has the molecular formula C20H29ClN2O4 and a molecular weight of 396.92 g/mol. Its IUPAC name is [4-[(3-chloro-2,2-dimethylpropanoyl)-[(4-methoxyphenyl)methyl]amino]cyclohexyl]carbamic acid.
| Compound Name | [4-[(3-chloro-2,2-dimethylpropanoyl)-[(4-methoxyphenyl)methyl]amino]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 89388746 |
| Molecular Formula | C20H29ClN2O4 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | [4-[(3-chloro-2,2-dimethylpropanoyl)-[(4-methoxyphenyl)methyl]amino]cyclohexyl]carbamic acid |
| SMILES | COc1ccc(CN(C(=O)C(C)(C)CCl)C2CCC(NC(=O)O)CC2)cc1 |
| InChI | InChI=1S/C20H29ClN2O4/c1-20(2,13-21)18(24)23(12-14-4-10-17(27-3)11-5-14)16-8-6-15(7-9-16)22-19(25)26/h4-5,10-11,15-16,22H,6-9,12-13H2,1-3H3,(H,25,26) |
| InChIKey | FVONKADLRXHNEJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|