C21H30F3N3O3 — CID 69285577
N'-[3-methoxy-5-(trifluoromethyl)phenyl]-N-[4-[methyl(propan-2-yl)amino]cyclohexyl]propanediamide (PubChem CID 69285577) has the molecular formula C21H30F3N3O3 and a molecular weight of 429.48 g/mol. Its IUPAC name is N'-[3-methoxy-5-(trifluoromethyl)phenyl]-N-[4-[methyl(propan-2-yl)amino]cyclohexyl]propanediamide.
| Compound Name | N'-[3-methoxy-5-(trifluoromethyl)phenyl]-N-[4-[methyl(propan-2-yl)amino]cyclohexyl]propanediamide |
|---|---|
| PubChem CID | 69285577 |
| Molecular Formula | C21H30F3N3O3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | N'-[3-methoxy-5-(trifluoromethyl)phenyl]-N-[4-[methyl(propan-2-yl)amino]cyclohexyl]propanediamide |
| SMILES | COc1cc(NC(=O)CC(=O)NC2CCC(N(C)C(C)C)CC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H30F3N3O3/c1-13(2)27(3)17-7-5-15(6-8-17)25-19(28)12-20(29)26-16-9-14(21(22,23)24)10-18(11-16)30-4/h9-11,13,15,17H,5-8,12H2,1-4H3,(H,25,28)(H,26,29) |
| InChIKey | KMYJYOADNVSURG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|