C14H12N2S — CID 692856
4-methyl-N-naphthalen-1-yl-1,3-thiazol-2-amine (PubChem CID 692856) has the molecular formula C14H12N2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 4-methyl-N-naphthalen-1-yl-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-N-naphthalen-1-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 692856 |
| Molecular Formula | C14H12N2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 4-methyl-N-naphthalen-1-yl-1,3-thiazol-2-amine |
| SMILES | Cc1csc(Nc2cccc3ccccc23)n1 |
| InChI | InChI=1S/C14H12N2S/c1-10-9-17-14(15-10)16-13-8-4-6-11-5-2-3-7-12(11)13/h2-9H,1H3,(H,15,16) |
| InChIKey | QNKLFDFMOINNIW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |