C14H17FNO4P — CID 69286860
[(3S,8aS)-3-(3-fluorophenyl)-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-6-yl]phosphonic acid (PubChem CID 69286860) has the molecular formula C14H17FNO4P and a molecular weight of 313.26 g/mol. Its IUPAC name is [(3S,8aS)-3-(3-fluorophenyl)-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-6-yl]phosphonic acid.
| Compound Name | [(3S,8aS)-3-(3-fluorophenyl)-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-6-yl]phosphonic acid |
|---|---|
| PubChem CID | 69286860 |
| Molecular Formula | C14H17FNO4P |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | [(3S,8aS)-3-(3-fluorophenyl)-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-6-yl]phosphonic acid |
| SMILES | O=C1C(P(=O)(O)O)CC[C@@H]2CC[C@@H](c3cccc(F)c3)N12 |
| InChI | InChI=1S/C14H17FNO4P/c15-10-3-1-2-9(8-10)12-6-4-11-5-7-13(21(18,19)20)14(17)16(11)12/h1-3,8,11-13H,4-7H2,(H2,18,19,20)/t11-,12-,13?/m0/s1 |
| InChIKey | SSAZDIZKPQCLDZ-VYAYZGMFSA-N |
| XLogP | 2.20 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|