C20H22ClN5O2 — CID 69290463
(2S)-N-[(4-carbamimidoylphenyl)methyl]-2-(4-imidazol-1-ylphenyl)-2-methoxyacetamide;hydrochloride (PubChem CID 69290463) has the molecular formula C20H22ClN5O2 and a molecular weight of 399.88 g/mol. Its IUPAC name is (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-(4-imidazol-1-ylphenyl)-2-methoxyacetamide;hydrochloride.
| Compound Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-(4-imidazol-1-ylphenyl)-2-methoxyacetamide;hydrochloride |
|---|---|
| PubChem CID | 69290463 |
| Molecular Formula | C20H22ClN5O2 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-(4-imidazol-1-ylphenyl)-2-methoxyacetamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(CNC(=O)[C@@H](OC)c2ccc(-n3ccnc3)cc2)cc1 |
| InChI | InChI=1S/C20H21N5O2.ClH/c1-27-18(15-6-8-17(9-7-15)25-11-10-23-13-25)20(26)24-12-14-2-4-16(5-3-14)19(21)22;/h2-11,13,18H,12H2,1H3,(H3,21,22)(H,24,26);1H/t18-;/m0./s1 |
| InChIKey | NYBSHKNZEFPFAO-FERBBOLQSA-N |
| XLogP | 2.58 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|