C31H33N5O — CID 69293022
6-[1-(benzylamino)ethyl]-N-[2-(2-tert-butylphenoxy)-3-pyridinyl]-1H-benzimidazol-2-amine (PubChem CID 69293022) has the molecular formula C31H33N5O and a molecular weight of 491.64 g/mol. Its IUPAC name is 6-[1-(benzylamino)ethyl]-N-[2-(2-tert-butylphenoxy)-3-pyridinyl]-1H-benzimidazol-2-amine.
| Compound Name | 6-[1-(benzylamino)ethyl]-N-[2-(2-tert-butylphenoxy)-3-pyridinyl]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 69293022 |
| Molecular Formula | C31H33N5O |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | 6-[1-(benzylamino)ethyl]-N-[2-(2-tert-butylphenoxy)-3-pyridinyl]-1H-benzimidazol-2-amine |
| SMILES | CC(NCc1ccccc1)c1ccc2nc(Nc3cccnc3Oc3ccccc3C(C)(C)C)[nH]c2c1 |
| InChI | InChI=1S/C31H33N5O/c1-21(33-20-22-11-6-5-7-12-22)23-16-17-25-27(19-23)36-30(34-25)35-26-14-10-18-32-29(26)37-28-15-9-8-13-24(28)31(2,3)4/h5-19,21,33H,20H2,1-4H3,(H2,34,35,36) |
| InChIKey | GXSIBTRSXMWDPC-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |