C23H21F3N4O — CID 11441710
6-tert-butyl-N-[2-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]-1H-benzimidazol-2-amine (PubChem CID 11441710) has the molecular formula C23H21F3N4O and a molecular weight of 426.44 g/mol. Its IUPAC name is 6-tert-butyl-N-[2-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]-1H-benzimidazol-2-amine.
| Compound Name | 6-tert-butyl-N-[2-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 11441710 |
| Molecular Formula | C23H21F3N4O |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 6-tert-butyl-N-[2-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]-1H-benzimidazol-2-amine |
| SMILES | CC(C)(C)c1ccc2nc(Nc3cccnc3Oc3cccc(C(F)(F)F)c3)[nH]c2c1 |
| InChI | InChI=1S/C23H21F3N4O/c1-22(2,3)14-9-10-17-19(13-14)30-21(28-17)29-18-8-5-11-27-20(18)31-16-7-4-6-15(12-16)23(24,25)26/h4-13H,1-3H3,(H2,28,29,30) |
| InChIKey | KQFPHPPYSGJBIV-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |