C19H15F3N4OS — CID 143083004
1-(2-aminophenyl)-3-[2-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]thiourea (PubChem CID 143083004) has the molecular formula C19H15F3N4OS and a molecular weight of 404.42 g/mol. Its IUPAC name is 1-(2-aminophenyl)-3-[2-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]thiourea.
| Compound Name | 1-(2-aminophenyl)-3-[2-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]thiourea |
|---|---|
| PubChem CID | 143083004 |
| Molecular Formula | C19H15F3N4OS |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 1-(2-aminophenyl)-3-[2-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]thiourea |
| SMILES | Nc1ccccc1NC(=S)Nc1cccnc1Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H15F3N4OS/c20-19(21,22)12-5-3-6-13(11-12)27-17-16(9-4-10-24-17)26-18(28)25-15-8-2-1-7-14(15)23/h1-11H,23H2,(H2,25,26,28) |
| InChIKey | LQEFMFWZTOFKLE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|