C22H21N3O3 — CID 69295483
2-[(4-naphthalen-1-ylpiperazine-1-carbonyl)amino]benzoic acid (PubChem CID 69295483) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 2-[(4-naphthalen-1-ylpiperazine-1-carbonyl)amino]benzoic acid.
| Compound Name | 2-[(4-naphthalen-1-ylpiperazine-1-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 69295483 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 2-[(4-naphthalen-1-ylpiperazine-1-carbonyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NC(=O)N1CCN(c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C22H21N3O3/c26-21(27)18-9-3-4-10-19(18)23-22(28)25-14-12-24(13-15-25)20-11-5-7-16-6-1-2-8-17(16)20/h1-11H,12-15H2,(H,23,28)(H,26,27) |
| InChIKey | KQIZTLXRRNOJPP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |