C33H24N2O4 — CID 69298204
2-[[6-(4-dibenzofuran-4-ylphenyl)pyridine-3-carbonyl]amino]-3-phenylpropanoic acid (PubChem CID 69298204) has the molecular formula C33H24N2O4 and a molecular weight of 512.57 g/mol. Its IUPAC name is 2-[[6-(4-dibenzofuran-4-ylphenyl)pyridine-3-carbonyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[6-(4-dibenzofuran-4-ylphenyl)pyridine-3-carbonyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 69298204 |
| Molecular Formula | C33H24N2O4 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | 2-[[6-(4-dibenzofuran-4-ylphenyl)pyridine-3-carbonyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)O)c1ccc(-c2ccc(-c3cccc4c3oc3ccccc34)cc2)nc1 |
| InChI | InChI=1S/C33H24N2O4/c36-32(35-29(33(37)38)19-21-7-2-1-3-8-21)24-17-18-28(34-20-24)23-15-13-22(14-16-23)25-10-6-11-27-26-9-4-5-12-30(26)39-31(25)27/h1-18,20,29H,19H2,(H,35,36)(H,37,38) |
| InChIKey | DDFFVHLURJIHEH-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |